C18H20F6N6O3 — CID 155717879
1-[2-[[(Z)-3-amino-1,1,1-trifluoro-4-hydrazinylbut-3-en-2-yl]amino]-2-oxoacetyl]-2-methyl-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide (PubChem CID 155717879) has the molecular formula C18H20F6N6O3 and a molecular weight of 482.39 g/mol. Its IUPAC name is 1-[2-[[(Z)-3-amino-1,1,1-trifluoro-4-hydrazinylbut-3-en-2-yl]amino]-2-oxoacetyl]-2-methyl-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-[2-[[(Z)-3-amino-1,1,1-trifluoro-4-hydrazinylbut-3-en-2-yl]amino]-2-oxoacetyl]-2-methyl-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 155717879 |
| Molecular Formula | C18H20F6N6O3 |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 1-[2-[[(Z)-3-amino-1,1,1-trifluoro-4-hydrazinylbut-3-en-2-yl]amino]-2-oxoacetyl]-2-methyl-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide |
| SMILES | CC1C(C(=O)Nc2cc(F)c(F)c(F)c2)CCN1C(=O)C(=O)NC(/C(N)=C/NN)C(F)(F)F |
| InChI | InChI=1S/C18H20F6N6O3/c1-7-9(15(31)28-8-4-10(19)13(21)11(20)5-8)2-3-30(7)17(33)16(32)29-14(18(22,23)24)12(25)6-27-26/h4-7,9,14,27H,2-3,25-26H2,1H3,(H,28,31)(H,29,32)/b12-6- |
| InChIKey | DWELRMHBERTNPH-SDQBBNPISA-N |
| XLogP | 0.59 |
| TPSA | 142.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|