C12H9F3N2O6 — CID 155717922
(2,5-dioxopyrrolidin-1-yl) 3-(2,5-dioxopyrrol-1-yl)-4,4,4-trifluorobutanoate (PubChem CID 155717922) has the molecular formula C12H9F3N2O6 and a molecular weight of 334.21 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-(2,5-dioxopyrrol-1-yl)-4,4,4-trifluorobutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-(2,5-dioxopyrrol-1-yl)-4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 155717922 |
| Molecular Formula | C12H9F3N2O6 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-(2,5-dioxopyrrol-1-yl)-4,4,4-trifluorobutanoate |
| SMILES | O=C(CC(N1C(=O)C=CC1=O)C(F)(F)F)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C12H9F3N2O6/c13-12(14,15)6(16-7(18)1-2-8(16)19)5-11(22)23-17-9(20)3-4-10(17)21/h1-2,6H,3-5H2 |
| InChIKey | USKAFXWGZBNOHK-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|