About 4-[(Z)-prop-1-enyl]-5-propyl-2,2-bis(trifluoromethyl)-1,3-dioxole
4-[(Z)-prop-1-enyl]-5-propyl-2,2-bis(trifluoromethyl)-1,3-dioxole (PubChem CID 155718084) has the molecular formula C11H12F6O2
and a molecular weight of 290.20 g/mol. Its IUPAC name is 4-[(Z)-prop-1-enyl]-5-propyl-2,2-bis(trifluoromethyl)-1,3-dioxole.
Molecular Properties
| Compound Name | 4-[(Z)-prop-1-enyl]-5-propyl-2,2-bis(trifluoromethyl)-1,3-dioxole |
| PubChem CID | 155718084 |
| Molecular Formula | C11H12F6O2 |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 4-[(Z)-prop-1-enyl]-5-propyl-2,2-bis(trifluoromethyl)-1,3-dioxole |
| SMILES | C/C=C\C1=C(CCC)OC(C(F)(F)F)(C(F)(F)F)O1 |
| InChI | InChI=1S/C11H12F6O2/c1-3-5-7-8(6-4-2)19-9(18-7,10(12,13)14)11(15,16)17/h3,5H,4,6H2,1-2H3/b5-3- |
| InChIKey | OLNQMFAUGDKVFF-HYXAFXHYSA-N |
| XLogP | 4.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(Z)-prop-1-enyl]-5-propyl-2,2-bis(trifluoromethyl)-1,3-dioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-prop-1-enyl]-5-propyl-2,2-bis(trifluoromethyl)-1,3-dioxole?
The IUPAC name of 4-[(Z)-prop-1-enyl]-5-propyl-2,2-bis(trifluoromethyl)-1,3-dioxole (CID 155718084) is 4-[(Z)-prop-1-enyl]-5-propyl-2,2-bis(trifluoromethyl)-1,3-dioxole.
What is the SMILES notation for 4-[(Z)-prop-1-enyl]-5-propyl-2,2-bis(trifluoromethyl)-1,3-dioxole?
The canonical SMILES for 4-[(Z)-prop-1-enyl]-5-propyl-2,2-bis(trifluoromethyl)-1,3-dioxole is C/C=C\C1=C(CCC)OC(C(F)(F)F)(C(F)(F)F)O1.
What is the InChIKey of 4-[(Z)-prop-1-enyl]-5-propyl-2,2-bis(trifluoromethyl)-1,3-dioxole?
The InChIKey is OLNQMFAUGDKVFF-HYXAFXHYSA-N. The full InChI is InChI=1S/C11H12F6O2/c1-3-5-7-8(6-4-2)19-9(18-7,10(12,13)14)11(15,16)17/h3,5H,4,6H2,1-2H3/b5-3-.
What are the key properties of 4-[(Z)-prop-1-enyl]-5-propyl-2,2-bis(trifluoromethyl)-1,3-dioxole?
4-[(Z)-prop-1-enyl]-5-propyl-2,2-bis(trifluoromethyl)-1,3-dioxole has a molecular weight of 290.20 g/mol, XLogP of 4.44, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-prop-1-enyl]-5-propyl-2,2-bis(trifluoromethyl)-1,3-dioxole is sourced from PubChem (CID 155718084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).