C9H6F6O2 — CID 155718095
2,2-bis(trifluoromethyl)-4,5-dihydro-1,3-benzodioxole (PubChem CID 155718095) has the molecular formula C9H6F6O2 and a molecular weight of 260.13 g/mol. Its IUPAC name is 2,2-bis(trifluoromethyl)-4,5-dihydro-1,3-benzodioxole.
| Compound Name | 2,2-bis(trifluoromethyl)-4,5-dihydro-1,3-benzodioxole |
|---|---|
| PubChem CID | 155718095 |
| Molecular Formula | C9H6F6O2 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 2,2-bis(trifluoromethyl)-4,5-dihydro-1,3-benzodioxole |
| SMILES | FC(F)(F)C1(C(F)(F)F)OC2=C(CCC=C2)O1 |
| InChI | InChI=1S/C9H6F6O2/c10-8(11,12)7(9(13,14)15)16-5-3-1-2-4-6(5)17-7/h1,3H,2,4H2 |
| InChIKey | FJLUTQHKWLVKAL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |