About [2-[2-(2-aminoacetyl)oxy-3-prop-2-enoxypropoxy]-2-oxoethyl]azanium;ethane;toluene
[2-[2-(2-aminoacetyl)oxy-3-prop-2-enoxypropoxy]-2-oxoethyl]azanium;ethane;toluene (PubChem CID 155718142) has the molecular formula C26H41N2O5+
and a molecular weight of 461.62 g/mol. Its IUPAC name is [2-[2-(2-aminoacetyl)oxy-3-prop-2-enoxypropoxy]-2-oxoethyl]azanium;ethane;toluene.
Molecular Properties
| Compound Name | [2-[2-(2-aminoacetyl)oxy-3-prop-2-enoxypropoxy]-2-oxoethyl]azanium;ethane;toluene |
| PubChem CID | 155718142 |
| Molecular Formula | C26H41N2O5+ |
| Molecular Weight | 461.62 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | [2-[2-(2-aminoacetyl)oxy-3-prop-2-enoxypropoxy]-2-oxoethyl]azanium;ethane;toluene |
| SMILES | C=CCOCC(COC(=O)C[NH3+])OC(=O)CN.CC.Cc1ccccc1.Cc1ccccc1 |
| InChI | InChI=1S/C10H18N2O5.2C7H8.C2H6/c1-2-3-15-6-8(17-10(14)5-12)7-16-9(13)4-11;2*1-7-5-3-2-4-6-7;1-2/h2,8H,1,3-7,11-12H2;2*2-6H,1H3;1-2H3/p+1 |
| InChIKey | ZYAZEVOQJJGUFI-UHFFFAOYSA-O |
| XLogP | 2.86 |
| TPSA | 115.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.62 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-[2-(2-aminoacetyl)oxy-3-prop-2-enoxypropoxy]-2-oxoethyl]azanium;ethane;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(2-aminoacetyl)oxy-3-prop-2-enoxypropoxy]-2-oxoethyl]azanium;ethane;toluene?
The IUPAC name of [2-[2-(2-aminoacetyl)oxy-3-prop-2-enoxypropoxy]-2-oxoethyl]azanium;ethane;toluene (CID 155718142) is [2-[2-(2-aminoacetyl)oxy-3-prop-2-enoxypropoxy]-2-oxoethyl]azanium;ethane;toluene.
What is the SMILES notation for [2-[2-(2-aminoacetyl)oxy-3-prop-2-enoxypropoxy]-2-oxoethyl]azanium;ethane;toluene?
The canonical SMILES for [2-[2-(2-aminoacetyl)oxy-3-prop-2-enoxypropoxy]-2-oxoethyl]azanium;ethane;toluene is C=CCOCC(COC(=O)C[NH3+])OC(=O)CN.CC.Cc1ccccc1.Cc1ccccc1.
What is the InChIKey of [2-[2-(2-aminoacetyl)oxy-3-prop-2-enoxypropoxy]-2-oxoethyl]azanium;ethane;toluene?
The InChIKey is ZYAZEVOQJJGUFI-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H18N2O5.2C7H8.C2H6/c1-2-3-15-6-8(17-10(14)5-12)7-16-9(13)4-11;2*1-7-5-3-2-4-6-7;1-2/h2,8H,1,3-7,11-12H2;2*2-6H,1H3;1-2H3/p+1.
What are the key properties of [2-[2-(2-aminoacetyl)oxy-3-prop-2-enoxypropoxy]-2-oxoethyl]azanium;ethane;toluene?
[2-[2-(2-aminoacetyl)oxy-3-prop-2-enoxypropoxy]-2-oxoethyl]azanium;ethane;toluene has a molecular weight of 461.62 g/mol, XLogP of 2.86, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(2-aminoacetyl)oxy-3-prop-2-enoxypropoxy]-2-oxoethyl]azanium;ethane;toluene is sourced from PubChem (CID 155718142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).