About (1S)-5-chloro-1-ethyl-2,3-dihydro-1H-indene
(1S)-5-chloro-1-ethyl-2,3-dihydro-1H-indene (PubChem CID 155718281) has the molecular formula C11H13Cl
and a molecular weight of 180.68 g/mol. Its IUPAC name is (1S)-5-chloro-1-ethyl-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | (1S)-5-chloro-1-ethyl-2,3-dihydro-1H-indene |
| PubChem CID | 155718281 |
| Molecular Formula | C11H13Cl |
| Molecular Weight | 180.68 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | (1S)-5-chloro-1-ethyl-2,3-dihydro-1H-indene |
| SMILES | CC[C@H]1CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C11H13Cl/c1-2-8-3-4-9-7-10(12)5-6-11(8)9/h5-8H,2-4H2,1H3/t8-/m0/s1 |
| InChIKey | LMRHZBVPOZSBBH-QMMMGPOBSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.68 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (1S)-5-chloro-1-ethyl-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-5-chloro-1-ethyl-2,3-dihydro-1H-indene?
The IUPAC name of (1S)-5-chloro-1-ethyl-2,3-dihydro-1H-indene (CID 155718281) is (1S)-5-chloro-1-ethyl-2,3-dihydro-1H-indene.
What is the SMILES notation for (1S)-5-chloro-1-ethyl-2,3-dihydro-1H-indene?
The canonical SMILES for (1S)-5-chloro-1-ethyl-2,3-dihydro-1H-indene is CC[C@H]1CCc2cc(Cl)ccc21.
What is the InChIKey of (1S)-5-chloro-1-ethyl-2,3-dihydro-1H-indene?
The InChIKey is LMRHZBVPOZSBBH-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H13Cl/c1-2-8-3-4-9-7-10(12)5-6-11(8)9/h5-8H,2-4H2,1H3/t8-/m0/s1.
What are the key properties of (1S)-5-chloro-1-ethyl-2,3-dihydro-1H-indene?
(1S)-5-chloro-1-ethyl-2,3-dihydro-1H-indene has a molecular weight of 180.68 g/mol, XLogP of 3.78, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-5-chloro-1-ethyl-2,3-dihydro-1H-indene is sourced from PubChem (CID 155718281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).