About 5-chloro-2,3-dihydro-1H-indene;2-hydroxy-3-methoxybenzamide
5-chloro-2,3-dihydro-1H-indene;2-hydroxy-3-methoxybenzamide (PubChem CID 155718393) has the molecular formula C17H18ClNO3
and a molecular weight of 319.79 g/mol. Its IUPAC name is 5-chloro-2,3-dihydro-1H-indene;2-hydroxy-3-methoxybenzamide.
Molecular Properties
| Compound Name | 5-chloro-2,3-dihydro-1H-indene;2-hydroxy-3-methoxybenzamide |
| PubChem CID | 155718393 |
| Molecular Formula | C17H18ClNO3 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 5-chloro-2,3-dihydro-1H-indene;2-hydroxy-3-methoxybenzamide |
| SMILES | COc1cccc(C(N)=O)c1O.Clc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C9H9Cl.C8H9NO3/c10-9-5-4-7-2-1-3-8(7)6-9;1-12-6-4-2-3-5(7(6)10)8(9)11/h4-6H,1-3H2;2-4,10H,1H3,(H2,9,11) |
| InChIKey | GYBRTGXOKPDIKH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-2,3-dihydro-1H-indene;2-hydroxy-3-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2,3-dihydro-1H-indene;2-hydroxy-3-methoxybenzamide?
The IUPAC name of 5-chloro-2,3-dihydro-1H-indene;2-hydroxy-3-methoxybenzamide (CID 155718393) is 5-chloro-2,3-dihydro-1H-indene;2-hydroxy-3-methoxybenzamide.
What is the SMILES notation for 5-chloro-2,3-dihydro-1H-indene;2-hydroxy-3-methoxybenzamide?
The canonical SMILES for 5-chloro-2,3-dihydro-1H-indene;2-hydroxy-3-methoxybenzamide is COc1cccc(C(N)=O)c1O.Clc1ccc2c(c1)CCC2.
What is the InChIKey of 5-chloro-2,3-dihydro-1H-indene;2-hydroxy-3-methoxybenzamide?
The InChIKey is GYBRTGXOKPDIKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl.C8H9NO3/c10-9-5-4-7-2-1-3-8(7)6-9;1-12-6-4-2-3-5(7(6)10)8(9)11/h4-6H,1-3H2;2-4,10H,1H3,(H2,9,11).
What are the key properties of 5-chloro-2,3-dihydro-1H-indene;2-hydroxy-3-methoxybenzamide?
5-chloro-2,3-dihydro-1H-indene;2-hydroxy-3-methoxybenzamide has a molecular weight of 319.79 g/mol, XLogP of 3.33, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,3-dihydro-1H-indene;2-hydroxy-3-methoxybenzamide is sourced from PubChem (CID 155718393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).