C20H26F3N4O2P — CID 155718407
methyl 2-[[(E)-3-amino-2-[(2,2-difluoro-2-phosphanylethyl)iminomethyl]but-2-enoyl]amino]-N-[1-(3-fluorophenyl)-2-methylprop-1-enyl]ethanimidate (PubChem CID 155718407) has the molecular formula C20H26F3N4O2P and a molecular weight of 442.42 g/mol. Its IUPAC name is methyl 2-[[(E)-3-amino-2-[(2,2-difluoro-2-phosphanylethyl)iminomethyl]but-2-enoyl]amino]-N-[1-(3-fluorophenyl)-2-methylprop-1-enyl]ethanimidate.
| Compound Name | methyl 2-[[(E)-3-amino-2-[(2,2-difluoro-2-phosphanylethyl)iminomethyl]but-2-enoyl]amino]-N-[1-(3-fluorophenyl)-2-methylprop-1-enyl]ethanimidate |
|---|---|
| PubChem CID | 155718407 |
| Molecular Formula | C20H26F3N4O2P |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | methyl 2-[[(E)-3-amino-2-[(2,2-difluoro-2-phosphanylethyl)iminomethyl]but-2-enoyl]amino]-N-[1-(3-fluorophenyl)-2-methylprop-1-enyl]ethanimidate |
| SMILES | CO/C(CNC(=O)C(/C=N/CC(F)(F)P)=C(\C)N)=N\C(=C(C)C)c1cccc(F)c1 |
| InChI | InChI=1S/C20H26F3N4O2P/c1-12(2)18(14-6-5-7-15(21)8-14)27-17(29-4)10-26-19(28)16(13(3)24)9-25-11-20(22,23)30/h5-9H,10-11,24,30H2,1-4H3,(H,26,28)/b16-13+,25-9+,27-17- |
| InChIKey | JTHJNVHIIQQSLZ-AFMQIASQSA-N |
| XLogP | 3.51 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|