About (4E)-6-imino-4,7-dimethylocta-1,4-dien-3-one
(4E)-6-imino-4,7-dimethylocta-1,4-dien-3-one (PubChem CID 155718440) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is (4E)-6-imino-4,7-dimethylocta-1,4-dien-3-one.
Molecular Properties
| Compound Name | (4E)-6-imino-4,7-dimethylocta-1,4-dien-3-one |
| PubChem CID | 155718440 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (4E)-6-imino-4,7-dimethylocta-1,4-dien-3-one |
| SMILES | [H]/N=C(/C=C(\C)C(=O)C=C)C(C)C |
| InChI | InChI=1S/C10H15NO/c1-5-10(12)8(4)6-9(11)7(2)3/h5-7,11H,1H2,2-4H3/b8-6+,11-9- |
| InChIKey | FEPWIIGTCSCQLJ-RVNZKKONSA-N |
| XLogP | 2.36 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4E)-6-imino-4,7-dimethylocta-1,4-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-6-imino-4,7-dimethylocta-1,4-dien-3-one?
The IUPAC name of (4E)-6-imino-4,7-dimethylocta-1,4-dien-3-one (CID 155718440) is (4E)-6-imino-4,7-dimethylocta-1,4-dien-3-one.
What is the SMILES notation for (4E)-6-imino-4,7-dimethylocta-1,4-dien-3-one?
The canonical SMILES for (4E)-6-imino-4,7-dimethylocta-1,4-dien-3-one is [H]/N=C(/C=C(\C)C(=O)C=C)C(C)C.
What is the InChIKey of (4E)-6-imino-4,7-dimethylocta-1,4-dien-3-one?
The InChIKey is FEPWIIGTCSCQLJ-RVNZKKONSA-N. The full InChI is InChI=1S/C10H15NO/c1-5-10(12)8(4)6-9(11)7(2)3/h5-7,11H,1H2,2-4H3/b8-6+,11-9-.
What are the key properties of (4E)-6-imino-4,7-dimethylocta-1,4-dien-3-one?
(4E)-6-imino-4,7-dimethylocta-1,4-dien-3-one has a molecular weight of 165.24 g/mol, XLogP of 2.36, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-6-imino-4,7-dimethylocta-1,4-dien-3-one is sourced from PubChem (CID 155718440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).