C22H26F4N4O — CID 155718446
(Z,2Z)-4-amino-2-(difluoromethylimino)-5-fluoro-N-[(2S)-3-[(E)-1-(3-fluorophenyl)prop-1-enyl]iminopent-4-en-2-yl]hept-3-enamide (PubChem CID 155718446) has the molecular formula C22H26F4N4O and a molecular weight of 438.47 g/mol. Its IUPAC name is (Z,2Z)-4-amino-2-(difluoromethylimino)-5-fluoro-N-[(2S)-3-[(E)-1-(3-fluorophenyl)prop-1-enyl]iminopent-4-en-2-yl]hept-3-enamide.
| Compound Name | (Z,2Z)-4-amino-2-(difluoromethylimino)-5-fluoro-N-[(2S)-3-[(E)-1-(3-fluorophenyl)prop-1-enyl]iminopent-4-en-2-yl]hept-3-enamide |
|---|---|
| PubChem CID | 155718446 |
| Molecular Formula | C22H26F4N4O |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | (Z,2Z)-4-amino-2-(difluoromethylimino)-5-fluoro-N-[(2S)-3-[(E)-1-(3-fluorophenyl)prop-1-enyl]iminopent-4-en-2-yl]hept-3-enamide |
| SMILES | C=C/C(=N\C(=C\C)c1cccc(F)c1)[C@H](C)NC(=O)C(/C=C(\N)C(F)CC)=N\C(F)F |
| InChI | InChI=1S/C22H26F4N4O/c1-5-16(24)17(27)12-20(30-22(25)26)21(31)28-13(4)18(6-2)29-19(7-3)14-9-8-10-15(23)11-14/h6-13,16,22H,2,5,27H2,1,3-4H3,(H,28,31)/b17-12-,19-7+,29-18+,30-20-/t13-,16?/m0/s1 |
| InChIKey | DRPSLVTXGSEAIO-MQQLYSDNSA-N |
| XLogP | 4.57 |
| TPSA | 79.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|