C25H36F2N4O — CID 155718447
(E)-5,5-difluoro-4-imino-N-[3-[(E)-1-(6-methyl-2-pyridinyl)prop-1-enyl]iminopent-4-en-2-yl]-2-[(E)-prop-1-enyl]hex-2-enamide;ethane;molecular hydrogen (PubChem CID 155718447) has the molecular formula C25H36F2N4O and a molecular weight of 446.59 g/mol. Its IUPAC name is (E)-5,5-difluoro-4-imino-N-[3-[(E)-1-(6-methyl-2-pyridinyl)prop-1-enyl]iminopent-4-en-2-yl]-2-[(E)-prop-1-enyl]hex-2-enamide;ethane;molecular hydrogen.
| Compound Name | (E)-5,5-difluoro-4-imino-N-[3-[(E)-1-(6-methyl-2-pyridinyl)prop-1-enyl]iminopent-4-en-2-yl]-2-[(E)-prop-1-enyl]hex-2-enamide;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 155718447 |
| Molecular Formula | C25H36F2N4O |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | (E)-5,5-difluoro-4-imino-N-[3-[(E)-1-(6-methyl-2-pyridinyl)prop-1-enyl]iminopent-4-en-2-yl]-2-[(E)-prop-1-enyl]hex-2-enamide;ethane;molecular hydrogen |
| SMILES | CC.[H]/N=C(/C=C(\C=C\C)C(=O)NC(C)/C(C=C)=N/C(=C/C)c1cccc(C)n1)C(C)(F)F.[H][H] |
| InChI | InChI=1S/C23H28F2N4O.C2H6.H2/c1-7-11-17(14-21(26)23(6,24)25)22(30)28-16(5)18(8-2)29-19(9-3)20-13-10-12-15(4)27-20;1-2;/h7-14,16,26H,2H2,1,3-6H3,(H,28,30);1-2H3;1H/b11-7+,17-14+,19-9+,26-21-,29-18+;; |
| InChIKey | ADBDSTJDXAGXQO-FPXRWRPJSA-N |
| XLogP | 6.33 |
| TPSA | 78.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|