C16H23FN2O — CID 155718546
methyl 2-amino-N-[1-(3-fluorophenyl)-2-methylprop-1-enyl]-3-methylbutanimidate (PubChem CID 155718546) has the molecular formula C16H23FN2O and a molecular weight of 278.37 g/mol. Its IUPAC name is methyl 2-amino-N-[1-(3-fluorophenyl)-2-methylprop-1-enyl]-3-methylbutanimidate.
| Compound Name | methyl 2-amino-N-[1-(3-fluorophenyl)-2-methylprop-1-enyl]-3-methylbutanimidate |
|---|---|
| PubChem CID | 155718546 |
| Molecular Formula | C16H23FN2O |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | methyl 2-amino-N-[1-(3-fluorophenyl)-2-methylprop-1-enyl]-3-methylbutanimidate |
| SMILES | CO/C(=N\C(=C(C)C)c1cccc(F)c1)C(N)C(C)C |
| InChI | InChI=1S/C16H23FN2O/c1-10(2)14(18)16(20-5)19-15(11(3)4)12-7-6-8-13(17)9-12/h6-10,14H,18H2,1-5H3/b19-16- |
| InChIKey | ZPKDQTZZUAIBLB-MNDPQUGUSA-N |
| XLogP | 3.60 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|