C27H36F3N3O3 — CID 155718570
ethane;methyl 3-[[(E)-5,5-difluoro-4-imino-2-[(E)-prop-1-enyl]hex-2-enoyl]amino]-4-[(E)-1-(3-fluorophenyl)prop-1-enyl]iminohex-5-enoate;molecular hydrogen (PubChem CID 155718570) has the molecular formula C27H36F3N3O3 and a molecular weight of 507.60 g/mol. Its IUPAC name is ethane;methyl 3-[[(E)-5,5-difluoro-4-imino-2-[(E)-prop-1-enyl]hex-2-enoyl]amino]-4-[(E)-1-(3-fluorophenyl)prop-1-enyl]iminohex-5-enoate;molecular hydrogen.
| Compound Name | ethane;methyl 3-[[(E)-5,5-difluoro-4-imino-2-[(E)-prop-1-enyl]hex-2-enoyl]amino]-4-[(E)-1-(3-fluorophenyl)prop-1-enyl]iminohex-5-enoate;molecular hydrogen |
|---|---|
| PubChem CID | 155718570 |
| Molecular Formula | C27H36F3N3O3 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | ethane;methyl 3-[[(E)-5,5-difluoro-4-imino-2-[(E)-prop-1-enyl]hex-2-enoyl]amino]-4-[(E)-1-(3-fluorophenyl)prop-1-enyl]iminohex-5-enoate;molecular hydrogen |
| SMILES | CC.[H]/N=C(/C=C(\C=C\C)C(=O)NC(CC(=O)OC)/C(C=C)=N/C(=C/C)c1cccc(F)c1)C(C)(F)F.[H][H] |
| InChI | InChI=1S/C25H28F3N3O3.C2H6.H2/c1-6-10-17(14-22(29)25(4,27)28)24(33)31-21(15-23(32)34-5)20(8-3)30-19(7-2)16-11-9-12-18(26)13-16;1-2;/h6-14,21,29H,3,15H2,1-2,4-5H3,(H,31,33);1-2H3;1H/b10-6+,17-14+,19-7+,29-22-,30-20+;; |
| InChIKey | VDGBHTVJRLJWKX-NPTHLUICSA-N |
| XLogP | 6.31 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|