About (E)-5,5-difluoro-2-methyl-4-methyliminopent-2-enoic acid;2-methylbutane
(E)-5,5-difluoro-2-methyl-4-methyliminopent-2-enoic acid;2-methylbutane (PubChem CID 155718656) has the molecular formula C12H21F2NO2
and a molecular weight of 249.30 g/mol. Its IUPAC name is (E)-5,5-difluoro-2-methyl-4-methyliminopent-2-enoic acid;2-methylbutane.
Molecular Properties
| Compound Name | (E)-5,5-difluoro-2-methyl-4-methyliminopent-2-enoic acid;2-methylbutane |
| PubChem CID | 155718656 |
| Molecular Formula | C12H21F2NO2 |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (E)-5,5-difluoro-2-methyl-4-methyliminopent-2-enoic acid;2-methylbutane |
| SMILES | C/N=C(/C=C(\C)C(=O)O)C(F)F.CCC(C)C |
| InChI | InChI=1S/C7H9F2NO2.C5H12/c1-4(7(11)12)3-5(10-2)6(8)9;1-4-5(2)3/h3,6H,1-2H3,(H,11,12);5H,4H2,1-3H3/b4-3+,10-5-; |
| InChIKey | VHSGAXDNXQQMEV-JLTMYBTNSA-N |
| XLogP | 3.41 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-5,5-difluoro-2-methyl-4-methyliminopent-2-enoic acid;2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5,5-difluoro-2-methyl-4-methyliminopent-2-enoic acid;2-methylbutane?
The IUPAC name of (E)-5,5-difluoro-2-methyl-4-methyliminopent-2-enoic acid;2-methylbutane (CID 155718656) is (E)-5,5-difluoro-2-methyl-4-methyliminopent-2-enoic acid;2-methylbutane.
What is the SMILES notation for (E)-5,5-difluoro-2-methyl-4-methyliminopent-2-enoic acid;2-methylbutane?
The canonical SMILES for (E)-5,5-difluoro-2-methyl-4-methyliminopent-2-enoic acid;2-methylbutane is C/N=C(/C=C(\C)C(=O)O)C(F)F.CCC(C)C.
What is the InChIKey of (E)-5,5-difluoro-2-methyl-4-methyliminopent-2-enoic acid;2-methylbutane?
The InChIKey is VHSGAXDNXQQMEV-JLTMYBTNSA-N. The full InChI is InChI=1S/C7H9F2NO2.C5H12/c1-4(7(11)12)3-5(10-2)6(8)9;1-4-5(2)3/h3,6H,1-2H3,(H,11,12);5H,4H2,1-3H3/b4-3+,10-5-;.
What are the key properties of (E)-5,5-difluoro-2-methyl-4-methyliminopent-2-enoic acid;2-methylbutane?
(E)-5,5-difluoro-2-methyl-4-methyliminopent-2-enoic acid;2-methylbutane has a molecular weight of 249.30 g/mol, XLogP of 3.41, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5,5-difluoro-2-methyl-4-methyliminopent-2-enoic acid;2-methylbutane is sourced from PubChem (CID 155718656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).