C14H12O3S — CID 155718904
4-benzylsulfanyl-2,3-dihydroxycyclohepta-2,4,6-trien-1-one (PubChem CID 155718904) has the molecular formula C14H12O3S and a molecular weight of 260.31 g/mol. Its IUPAC name is 4-benzylsulfanyl-2,3-dihydroxycyclohepta-2,4,6-trien-1-one.
| Compound Name | 4-benzylsulfanyl-2,3-dihydroxycyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 155718904 |
| Molecular Formula | C14H12O3S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 4-benzylsulfanyl-2,3-dihydroxycyclohepta-2,4,6-trien-1-one |
| SMILES | O=c1cccc(SCc2ccccc2)c(O)c1O |
| InChI | InChI=1S/C14H12O3S/c15-11-7-4-8-12(14(17)13(11)16)18-9-10-5-2-1-3-6-10/h1-8H,9H2,(H2,15,16,17) |
| InChIKey | CEGIIPLPAFEQIZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |