About 3-ethenyl-1-ethyl-4-(1-fluoroethenyl)-2,5-dihydropyrrole
3-ethenyl-1-ethyl-4-(1-fluoroethenyl)-2,5-dihydropyrrole (PubChem CID 155719567) has the molecular formula C10H14FN
and a molecular weight of 167.23 g/mol. Its IUPAC name is 3-ethenyl-1-ethyl-4-(1-fluoroethenyl)-2,5-dihydropyrrole.
Molecular Properties
| Compound Name | 3-ethenyl-1-ethyl-4-(1-fluoroethenyl)-2,5-dihydropyrrole |
| PubChem CID | 155719567 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 3-ethenyl-1-ethyl-4-(1-fluoroethenyl)-2,5-dihydropyrrole |
| SMILES | C=CC1=C(C(=C)F)CN(CC)C1 |
| InChI | InChI=1S/C10H14FN/c1-4-9-6-12(5-2)7-10(9)8(3)11/h4H,1,3,5-7H2,2H3 |
| InChIKey | PXVFQAFNZOLRFK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethenyl-1-ethyl-4-(1-fluoroethenyl)-2,5-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-1-ethyl-4-(1-fluoroethenyl)-2,5-dihydropyrrole?
The IUPAC name of 3-ethenyl-1-ethyl-4-(1-fluoroethenyl)-2,5-dihydropyrrole (CID 155719567) is 3-ethenyl-1-ethyl-4-(1-fluoroethenyl)-2,5-dihydropyrrole.
What is the SMILES notation for 3-ethenyl-1-ethyl-4-(1-fluoroethenyl)-2,5-dihydropyrrole?
The canonical SMILES for 3-ethenyl-1-ethyl-4-(1-fluoroethenyl)-2,5-dihydropyrrole is C=CC1=C(C(=C)F)CN(CC)C1.
What is the InChIKey of 3-ethenyl-1-ethyl-4-(1-fluoroethenyl)-2,5-dihydropyrrole?
The InChIKey is PXVFQAFNZOLRFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FN/c1-4-9-6-12(5-2)7-10(9)8(3)11/h4H,1,3,5-7H2,2H3.
What are the key properties of 3-ethenyl-1-ethyl-4-(1-fluoroethenyl)-2,5-dihydropyrrole?
3-ethenyl-1-ethyl-4-(1-fluoroethenyl)-2,5-dihydropyrrole has a molecular weight of 167.23 g/mol, XLogP of 2.29, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-1-ethyl-4-(1-fluoroethenyl)-2,5-dihydropyrrole is sourced from PubChem (CID 155719567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).