C18H29N3 — CID 155719568
2-(2-methylbutan-2-yl)-5-(4-methylpiperazin-1-yl)-1,3-dihydroisoindole (PubChem CID 155719568) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is 2-(2-methylbutan-2-yl)-5-(4-methylpiperazin-1-yl)-1,3-dihydroisoindole.
| Compound Name | 2-(2-methylbutan-2-yl)-5-(4-methylpiperazin-1-yl)-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 155719568 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | 2-(2-methylbutan-2-yl)-5-(4-methylpiperazin-1-yl)-1,3-dihydroisoindole |
| SMILES | CCC(C)(C)N1Cc2ccc(N3CCN(C)CC3)cc2C1 |
| InChI | InChI=1S/C18H29N3/c1-5-18(2,3)21-13-15-6-7-17(12-16(15)14-21)20-10-8-19(4)9-11-20/h6-7,12H,5,8-11,13-14H2,1-4H3 |
| InChIKey | WUNTXBQXHVJTOU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|