C23H31Cl2N5O4S — CID 155720211
(2Z,4Z)-4-[4-[6-(aminomethyl)-3,5-dioxo-1,2,4-triazin-2-yl]-2,6-dichlorophenoxy]-N,5-dimethyl-2-propan-2-ylhepta-2,4-dienamide;methanethiol (PubChem CID 155720211) has the molecular formula C23H31Cl2N5O4S and a molecular weight of 544.51 g/mol. Its IUPAC name is (2Z,4Z)-4-[4-[6-(aminomethyl)-3,5-dioxo-1,2,4-triazin-2-yl]-2,6-dichlorophenoxy]-N,5-dimethyl-2-propan-2-ylhepta-2,4-dienamide;methanethiol.
| Compound Name | (2Z,4Z)-4-[4-[6-(aminomethyl)-3,5-dioxo-1,2,4-triazin-2-yl]-2,6-dichlorophenoxy]-N,5-dimethyl-2-propan-2-ylhepta-2,4-dienamide;methanethiol |
|---|---|
| PubChem CID | 155720211 |
| Molecular Formula | C23H31Cl2N5O4S |
| Molecular Weight | 544.51 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | (2Z,4Z)-4-[4-[6-(aminomethyl)-3,5-dioxo-1,2,4-triazin-2-yl]-2,6-dichlorophenoxy]-N,5-dimethyl-2-propan-2-ylhepta-2,4-dienamide;methanethiol |
| SMILES | CC/C(C)=C(/C=C(\C(=O)NC)C(C)C)Oc1c(Cl)cc(-n2nc(CN)c(=O)[nH]c2=O)cc1Cl.CS |
| InChI | InChI=1S/C22H27Cl2N5O4.CH4S/c1-6-12(4)18(9-14(11(2)3)20(30)26-5)33-19-15(23)7-13(8-16(19)24)29-22(32)27-21(31)17(10-25)28-29;1-2/h7-9,11H,6,10,25H2,1-5H3,(H,26,30)(H,27,31,32);2H,1H3/b14-9-,18-12-; |
| InChIKey | CMADFXRBZZJSAO-XAYUWMJUSA-N |
| XLogP | 3.62 |
| TPSA | 132.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|