C19H21Cl2N5O4 — CID 155720231
(2Z)-4-[4-[6-(aminomethyl)-3,5-dioxo-1,2,4-triazin-2-yl]-2,6-dichlorophenoxy]-N-methyl-2-propan-2-ylpenta-2,4-dienamide (PubChem CID 155720231) has the molecular formula C19H21Cl2N5O4 and a molecular weight of 454.31 g/mol. Its IUPAC name is (2Z)-4-[4-[6-(aminomethyl)-3,5-dioxo-1,2,4-triazin-2-yl]-2,6-dichlorophenoxy]-N-methyl-2-propan-2-ylpenta-2,4-dienamide.
| Compound Name | (2Z)-4-[4-[6-(aminomethyl)-3,5-dioxo-1,2,4-triazin-2-yl]-2,6-dichlorophenoxy]-N-methyl-2-propan-2-ylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 155720231 |
| Molecular Formula | C19H21Cl2N5O4 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | (2Z)-4-[4-[6-(aminomethyl)-3,5-dioxo-1,2,4-triazin-2-yl]-2,6-dichlorophenoxy]-N-methyl-2-propan-2-ylpenta-2,4-dienamide |
| SMILES | C=C(/C=C(\C(=O)NC)C(C)C)Oc1c(Cl)cc(-n2nc(CN)c(=O)[nH]c2=O)cc1Cl |
| InChI | InChI=1S/C19H21Cl2N5O4/c1-9(2)12(17(27)23-4)5-10(3)30-16-13(20)6-11(7-14(16)21)26-19(29)24-18(28)15(8-22)25-26/h5-7,9H,3,8,22H2,1-2,4H3,(H,23,27)(H,24,28,29)/b12-5- |
| InChIKey | KTMPGGZLQNXTGP-XGICHPGQSA-N |
| XLogP | 1.91 |
| TPSA | 132.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|