C28H31Cl2N5O4 — CID 155720327
2-[4-[(3-acetyl-1H-indol-5-yl)oxy]-3,5-dichlorophenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile;2,3-dimethylbutane;ethane (PubChem CID 155720327) has the molecular formula C28H31Cl2N5O4 and a molecular weight of 572.49 g/mol. Its IUPAC name is 2-[4-[(3-acetyl-1H-indol-5-yl)oxy]-3,5-dichlorophenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile;2,3-dimethylbutane;ethane.
| Compound Name | 2-[4-[(3-acetyl-1H-indol-5-yl)oxy]-3,5-dichlorophenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile;2,3-dimethylbutane;ethane |
|---|---|
| PubChem CID | 155720327 |
| Molecular Formula | C28H31Cl2N5O4 |
| Molecular Weight | 572.49 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 2-[4-[(3-acetyl-1H-indol-5-yl)oxy]-3,5-dichlorophenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile;2,3-dimethylbutane;ethane |
| SMILES | CC.CC(=O)c1c[nH]c2ccc(Oc3c(Cl)cc(-n4nc(C#N)c(=O)[nH]c4=O)cc3Cl)cc12.CC(C)C(C)C |
| InChI | InChI=1S/C20H11Cl2N5O4.C6H14.C2H6/c1-9(28)13-8-24-16-3-2-11(6-12(13)16)31-18-14(21)4-10(5-15(18)22)27-20(30)25-19(29)17(7-23)26-27;1-5(2)6(3)4;1-2/h2-6,8,24H,1H3,(H,25,29,30);5-6H,1-4H3;1-2H3 |
| InChIKey | KNNLKEKJNCFOJF-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.49 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |