C27H31Cl2N5O4 — CID 155720349
2-[4-[(3-acetyl-1H-indol-5-yl)oxy]-3,5-dichlorophenyl]-6-(aziridin-2-yl)-1,2,4-triazine-3,5-dione;butane;ethane (PubChem CID 155720349) has the molecular formula C27H31Cl2N5O4 and a molecular weight of 560.48 g/mol. Its IUPAC name is 2-[4-[(3-acetyl-1H-indol-5-yl)oxy]-3,5-dichlorophenyl]-6-(aziridin-2-yl)-1,2,4-triazine-3,5-dione;butane;ethane.
| Compound Name | 2-[4-[(3-acetyl-1H-indol-5-yl)oxy]-3,5-dichlorophenyl]-6-(aziridin-2-yl)-1,2,4-triazine-3,5-dione;butane;ethane |
|---|---|
| PubChem CID | 155720349 |
| Molecular Formula | C27H31Cl2N5O4 |
| Molecular Weight | 560.48 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | 2-[4-[(3-acetyl-1H-indol-5-yl)oxy]-3,5-dichlorophenyl]-6-(aziridin-2-yl)-1,2,4-triazine-3,5-dione;butane;ethane |
| SMILES | CC.CC(=O)c1c[nH]c2ccc(Oc3c(Cl)cc(-n4nc(C5CN5)c(=O)[nH]c4=O)cc3Cl)cc12.CCCC |
| InChI | InChI=1S/C21H15Cl2N5O4.C4H10.C2H6/c1-9(29)13-7-24-16-3-2-11(6-12(13)16)32-19-14(22)4-10(5-15(19)23)28-21(31)26-20(30)18(27-28)17-8-25-17;1-3-4-2;1-2/h2-7,17,24-25H,8H2,1H3,(H,26,30,31);3-4H2,1-2H3;1-2H3 |
| InChIKey | DAXILSXUXPNTAJ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.48 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|