C24H33Cl2N5O4 — CID 155720447
(2Z)-4-[2,6-dichloro-4-[6-[(dimethylamino)methyl]-3,5-dioxo-1,2,4-triazin-2-yl]phenoxy]-N-methyl-2-propan-2-ylpenta-2,4-dienamide;propane (PubChem CID 155720447) has the molecular formula C24H33Cl2N5O4 and a molecular weight of 526.47 g/mol. Its IUPAC name is (2Z)-4-[2,6-dichloro-4-[6-[(dimethylamino)methyl]-3,5-dioxo-1,2,4-triazin-2-yl]phenoxy]-N-methyl-2-propan-2-ylpenta-2,4-dienamide;propane.
| Compound Name | (2Z)-4-[2,6-dichloro-4-[6-[(dimethylamino)methyl]-3,5-dioxo-1,2,4-triazin-2-yl]phenoxy]-N-methyl-2-propan-2-ylpenta-2,4-dienamide;propane |
|---|---|
| PubChem CID | 155720447 |
| Molecular Formula | C24H33Cl2N5O4 |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | (2Z)-4-[2,6-dichloro-4-[6-[(dimethylamino)methyl]-3,5-dioxo-1,2,4-triazin-2-yl]phenoxy]-N-methyl-2-propan-2-ylpenta-2,4-dienamide;propane |
| SMILES | C=C(/C=C(\C(=O)NC)C(C)C)Oc1c(Cl)cc(-n2nc(CN(C)C)c(=O)[nH]c2=O)cc1Cl.CCC |
| InChI | InChI=1S/C21H25Cl2N5O4.C3H8/c1-11(2)14(19(29)24-4)7-12(3)32-18-15(22)8-13(9-16(18)23)28-21(31)25-20(30)17(26-28)10-27(5)6;1-3-2/h7-9,11H,3,10H2,1-2,4-6H3,(H,24,29)(H,25,30,31);3H2,1-2H3/b14-7-; |
| InChIKey | VOSUKNBBOCDZRU-KIUKIJHYSA-N |
| XLogP | 3.93 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|