C28H39N7O7 — CID 155720638
benzyl 3-[[[2-[[(2S)-2-[[amino(benzyl)carbamoyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanoyl]amino]acetyl]amino]-carbamoylamino]propanoate (PubChem CID 155720638) has the molecular formula C28H39N7O7 and a molecular weight of 585.66 g/mol. Its IUPAC name is benzyl 3-[[[2-[[(2S)-2-[[amino(benzyl)carbamoyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanoyl]amino]acetyl]amino]-carbamoylamino]propanoate.
| Compound Name | benzyl 3-[[[2-[[(2S)-2-[[amino(benzyl)carbamoyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanoyl]amino]acetyl]amino]-carbamoylamino]propanoate |
|---|---|
| PubChem CID | 155720638 |
| Molecular Formula | C28H39N7O7 |
| Molecular Weight | 585.66 g/mol |
| Exact Mass | 585.29 |
| IUPAC Name | benzyl 3-[[[2-[[(2S)-2-[[amino(benzyl)carbamoyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanoyl]amino]acetyl]amino]-carbamoylamino]propanoate |
| SMILES | CC(C)(C)OC[C@H](NC(=O)N(N)Cc1ccccc1)C(=O)NCC(=O)NN(CCC(=O)OCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C28H39N7O7/c1-28(2,3)42-19-22(32-27(40)34(30)17-20-10-6-4-7-11-20)25(38)31-16-23(36)33-35(26(29)39)15-14-24(37)41-18-21-12-8-5-9-13-21/h4-13,22H,14-19,30H2,1-3H3,(H2,29,39)(H,31,38)(H,32,40)(H,33,36)/t22-/m0/s1 |
| InChIKey | VHIDVDODQMFRKR-QFIPXVFZSA-N |
| XLogP | 0.92 |
| TPSA | 198.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.66 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|