C36H40FNO4 — CID 155721064
[(2R,3R,4R,5S)-1-[3-(4-fluorophenyl)propyl]-3,4,5-tris(phenylmethoxy)piperidin-2-yl]methanol (PubChem CID 155721064) has the molecular formula C36H40FNO4 and a molecular weight of 569.72 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-1-[3-(4-fluorophenyl)propyl]-3,4,5-tris(phenylmethoxy)piperidin-2-yl]methanol.
| Compound Name | [(2R,3R,4R,5S)-1-[3-(4-fluorophenyl)propyl]-3,4,5-tris(phenylmethoxy)piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 155721064 |
| Molecular Formula | C36H40FNO4 |
| Molecular Weight | 569.72 g/mol |
| Exact Mass | 569.29 |
| IUPAC Name | [(2R,3R,4R,5S)-1-[3-(4-fluorophenyl)propyl]-3,4,5-tris(phenylmethoxy)piperidin-2-yl]methanol |
| SMILES | OC[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)CN1CCCc1ccc(F)cc1 |
| InChI | InChI=1S/C36H40FNO4/c37-32-20-18-28(19-21-32)17-10-22-38-23-34(40-25-29-11-4-1-5-12-29)36(42-27-31-15-8-3-9-16-31)35(33(38)24-39)41-26-30-13-6-2-7-14-30/h1-9,11-16,18-21,33-36,39H,10,17,22-27H2/t33-,34+,35-,36-/m1/s1 |
| InChIKey | DHGLDXILHSNTOT-IYKITFJXSA-N |
| XLogP | 6.19 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.72 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |