About 1,2-dimethylpiperidin-4-ol;3-pyrrolidin-1-yl-2-(trifluoromethyl)pyridine
1,2-dimethylpiperidin-4-ol;3-pyrrolidin-1-yl-2-(trifluoromethyl)pyridine (PubChem CID 155721068) has the molecular formula C17H26F3N3O
and a molecular weight of 345.41 g/mol. Its IUPAC name is 1,2-dimethylpiperidin-4-ol;3-pyrrolidin-1-yl-2-(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | 1,2-dimethylpiperidin-4-ol;3-pyrrolidin-1-yl-2-(trifluoromethyl)pyridine |
| PubChem CID | 155721068 |
| Molecular Formula | C17H26F3N3O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | 1,2-dimethylpiperidin-4-ol;3-pyrrolidin-1-yl-2-(trifluoromethyl)pyridine |
| SMILES | CC1CC(O)CCN1C.FC(F)(F)c1ncccc1N1CCCC1 |
| InChI | InChI=1S/C10H11F3N2.C7H15NO/c11-10(12,13)9-8(4-3-5-14-9)15-6-1-2-7-15;1-6-5-7(9)3-4-8(6)2/h3-5H,1-2,6-7H2;6-7,9H,3-5H2,1-2H3 |
| InChIKey | JDHDGTKJQQBYCY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,2-dimethylpiperidin-4-ol;3-pyrrolidin-1-yl-2-(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylpiperidin-4-ol;3-pyrrolidin-1-yl-2-(trifluoromethyl)pyridine?
The IUPAC name of 1,2-dimethylpiperidin-4-ol;3-pyrrolidin-1-yl-2-(trifluoromethyl)pyridine (CID 155721068) is 1,2-dimethylpiperidin-4-ol;3-pyrrolidin-1-yl-2-(trifluoromethyl)pyridine.
What is the SMILES notation for 1,2-dimethylpiperidin-4-ol;3-pyrrolidin-1-yl-2-(trifluoromethyl)pyridine?
The canonical SMILES for 1,2-dimethylpiperidin-4-ol;3-pyrrolidin-1-yl-2-(trifluoromethyl)pyridine is CC1CC(O)CCN1C.FC(F)(F)c1ncccc1N1CCCC1.
What is the InChIKey of 1,2-dimethylpiperidin-4-ol;3-pyrrolidin-1-yl-2-(trifluoromethyl)pyridine?
The InChIKey is JDHDGTKJQQBYCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3N2.C7H15NO/c11-10(12,13)9-8(4-3-5-14-9)15-6-1-2-7-15;1-6-5-7(9)3-4-8(6)2/h3-5H,1-2,6-7H2;6-7,9H,3-5H2,1-2H3.
What are the key properties of 1,2-dimethylpiperidin-4-ol;3-pyrrolidin-1-yl-2-(trifluoromethyl)pyridine?
1,2-dimethylpiperidin-4-ol;3-pyrrolidin-1-yl-2-(trifluoromethyl)pyridine has a molecular weight of 345.41 g/mol, XLogP of 3.16, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylpiperidin-4-ol;3-pyrrolidin-1-yl-2-(trifluoromethyl)pyridine is sourced from PubChem (CID 155721068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).