C34H41F2NO3 — CID 155721069
(2R,3R,4R,5S)-1-[(4,4-difluorocyclohexyl)methyl]-2-methyl-3,4,5-tris(phenylmethoxy)piperidine (PubChem CID 155721069) has the molecular formula C34H41F2NO3 and a molecular weight of 549.70 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[(4,4-difluorocyclohexyl)methyl]-2-methyl-3,4,5-tris(phenylmethoxy)piperidine.
| Compound Name | (2R,3R,4R,5S)-1-[(4,4-difluorocyclohexyl)methyl]-2-methyl-3,4,5-tris(phenylmethoxy)piperidine |
|---|---|
| PubChem CID | 155721069 |
| Molecular Formula | C34H41F2NO3 |
| Molecular Weight | 549.70 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | (2R,3R,4R,5S)-1-[(4,4-difluorocyclohexyl)methyl]-2-methyl-3,4,5-tris(phenylmethoxy)piperidine |
| SMILES | C[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)CN1CC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C34H41F2NO3/c1-26-32(39-24-29-13-7-3-8-14-29)33(40-25-30-15-9-4-10-16-30)31(38-23-28-11-5-2-6-12-28)22-37(26)21-27-17-19-34(35,36)20-18-27/h2-16,26-27,31-33H,17-25H2,1H3/t26-,31+,32-,33-/m1/s1 |
| InChIKey | UMXACUUOOZWQBJ-CQNOCZQGSA-N |
| XLogP | 7.27 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.70 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |