About 2-methyl-1-[[4-(trifluoromethyl)cyclohexyl]methyl]piperidine-3,4,5-triol
2-methyl-1-[[4-(trifluoromethyl)cyclohexyl]methyl]piperidine-3,4,5-triol (PubChem CID 155721083) has the molecular formula C14H24F3NO3
and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-methyl-1-[[4-(trifluoromethyl)cyclohexyl]methyl]piperidine-3,4,5-triol.
Molecular Properties
| Compound Name | 2-methyl-1-[[4-(trifluoromethyl)cyclohexyl]methyl]piperidine-3,4,5-triol |
| PubChem CID | 155721083 |
| Molecular Formula | C14H24F3NO3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 2-methyl-1-[[4-(trifluoromethyl)cyclohexyl]methyl]piperidine-3,4,5-triol |
| SMILES | CC1C(O)C(O)C(O)CN1CC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H24F3NO3/c1-8-12(20)13(21)11(19)7-18(8)6-9-2-4-10(5-3-9)14(15,16)17/h8-13,19-21H,2-7H2,1H3 |
| InChIKey | DFJRGPMTHQMJQJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-1-[[4-(trifluoromethyl)cyclohexyl]methyl]piperidine-3,4,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-[[4-(trifluoromethyl)cyclohexyl]methyl]piperidine-3,4,5-triol?
The IUPAC name of 2-methyl-1-[[4-(trifluoromethyl)cyclohexyl]methyl]piperidine-3,4,5-triol (CID 155721083) is 2-methyl-1-[[4-(trifluoromethyl)cyclohexyl]methyl]piperidine-3,4,5-triol.
What is the SMILES notation for 2-methyl-1-[[4-(trifluoromethyl)cyclohexyl]methyl]piperidine-3,4,5-triol?
The canonical SMILES for 2-methyl-1-[[4-(trifluoromethyl)cyclohexyl]methyl]piperidine-3,4,5-triol is CC1C(O)C(O)C(O)CN1CC1CCC(C(F)(F)F)CC1.
What is the InChIKey of 2-methyl-1-[[4-(trifluoromethyl)cyclohexyl]methyl]piperidine-3,4,5-triol?
The InChIKey is DFJRGPMTHQMJQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24F3NO3/c1-8-12(20)13(21)11(19)7-18(8)6-9-2-4-10(5-3-9)14(15,16)17/h8-13,19-21H,2-7H2,1H3.
What are the key properties of 2-methyl-1-[[4-(trifluoromethyl)cyclohexyl]methyl]piperidine-3,4,5-triol?
2-methyl-1-[[4-(trifluoromethyl)cyclohexyl]methyl]piperidine-3,4,5-triol has a molecular weight of 311.34 g/mol, XLogP of 1.14, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-[[4-(trifluoromethyl)cyclohexyl]methyl]piperidine-3,4,5-triol is sourced from PubChem (CID 155721083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).