About 1,2-dimethylpiperidin-4-ol;2-piperidin-1-yl-4-(trifluoromethyl)-1,3-thiazole
1,2-dimethylpiperidin-4-ol;2-piperidin-1-yl-4-(trifluoromethyl)-1,3-thiazole (PubChem CID 155721188) has the molecular formula C16H26F3N3OS
and a molecular weight of 365.47 g/mol. Its IUPAC name is 1,2-dimethylpiperidin-4-ol;2-piperidin-1-yl-4-(trifluoromethyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 1,2-dimethylpiperidin-4-ol;2-piperidin-1-yl-4-(trifluoromethyl)-1,3-thiazole |
| PubChem CID | 155721188 |
| Molecular Formula | C16H26F3N3OS |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1,2-dimethylpiperidin-4-ol;2-piperidin-1-yl-4-(trifluoromethyl)-1,3-thiazole |
| SMILES | CC1CC(O)CCN1C.FC(F)(F)c1csc(N2CCCCC2)n1 |
| InChI | InChI=1S/C9H11F3N2S.C7H15NO/c10-9(11,12)7-6-15-8(13-7)14-4-2-1-3-5-14;1-6-5-7(9)3-4-8(6)2/h6H,1-5H2;6-7,9H,3-5H2,1-2H3 |
| InChIKey | YYHDZAIXAZJJEO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,2-dimethylpiperidin-4-ol;2-piperidin-1-yl-4-(trifluoromethyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylpiperidin-4-ol;2-piperidin-1-yl-4-(trifluoromethyl)-1,3-thiazole?
The IUPAC name of 1,2-dimethylpiperidin-4-ol;2-piperidin-1-yl-4-(trifluoromethyl)-1,3-thiazole (CID 155721188) is 1,2-dimethylpiperidin-4-ol;2-piperidin-1-yl-4-(trifluoromethyl)-1,3-thiazole.
What is the SMILES notation for 1,2-dimethylpiperidin-4-ol;2-piperidin-1-yl-4-(trifluoromethyl)-1,3-thiazole?
The canonical SMILES for 1,2-dimethylpiperidin-4-ol;2-piperidin-1-yl-4-(trifluoromethyl)-1,3-thiazole is CC1CC(O)CCN1C.FC(F)(F)c1csc(N2CCCCC2)n1.
What is the InChIKey of 1,2-dimethylpiperidin-4-ol;2-piperidin-1-yl-4-(trifluoromethyl)-1,3-thiazole?
The InChIKey is YYHDZAIXAZJJEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3N2S.C7H15NO/c10-9(11,12)7-6-15-8(13-7)14-4-2-1-3-5-14;1-6-5-7(9)3-4-8(6)2/h6H,1-5H2;6-7,9H,3-5H2,1-2H3.
What are the key properties of 1,2-dimethylpiperidin-4-ol;2-piperidin-1-yl-4-(trifluoromethyl)-1,3-thiazole?
1,2-dimethylpiperidin-4-ol;2-piperidin-1-yl-4-(trifluoromethyl)-1,3-thiazole has a molecular weight of 365.47 g/mol, XLogP of 3.61, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylpiperidin-4-ol;2-piperidin-1-yl-4-(trifluoromethyl)-1,3-thiazole is sourced from PubChem (CID 155721188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).