About 1,2-dimethylpiperidin-4-ol;trifluoromethylcyclohexane
1,2-dimethylpiperidin-4-ol;trifluoromethylcyclohexane (PubChem CID 155721197) has the molecular formula C14H26F3NO
and a molecular weight of 281.36 g/mol. Its IUPAC name is 1,2-dimethylpiperidin-4-ol;trifluoromethylcyclohexane.
Molecular Properties
| Compound Name | 1,2-dimethylpiperidin-4-ol;trifluoromethylcyclohexane |
| PubChem CID | 155721197 |
| Molecular Formula | C14H26F3NO |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 1,2-dimethylpiperidin-4-ol;trifluoromethylcyclohexane |
| SMILES | CC1CC(O)CCN1C.FC(F)(F)C1CCCCC1 |
| InChI | InChI=1S/C7H11F3.C7H15NO/c8-7(9,10)6-4-2-1-3-5-6;1-6-5-7(9)3-4-8(6)2/h6H,1-5H2;6-7,9H,3-5H2,1-2H3 |
| InChIKey | SLBUWAPAMYMPCS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-dimethylpiperidin-4-ol;trifluoromethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylpiperidin-4-ol;trifluoromethylcyclohexane?
The IUPAC name of 1,2-dimethylpiperidin-4-ol;trifluoromethylcyclohexane (CID 155721197) is 1,2-dimethylpiperidin-4-ol;trifluoromethylcyclohexane.
What is the SMILES notation for 1,2-dimethylpiperidin-4-ol;trifluoromethylcyclohexane?
The canonical SMILES for 1,2-dimethylpiperidin-4-ol;trifluoromethylcyclohexane is CC1CC(O)CCN1C.FC(F)(F)C1CCCCC1.
What is the InChIKey of 1,2-dimethylpiperidin-4-ol;trifluoromethylcyclohexane?
The InChIKey is SLBUWAPAMYMPCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F3.C7H15NO/c8-7(9,10)6-4-2-1-3-5-6;1-6-5-7(9)3-4-8(6)2/h6H,1-5H2;6-7,9H,3-5H2,1-2H3.
What are the key properties of 1,2-dimethylpiperidin-4-ol;trifluoromethylcyclohexane?
1,2-dimethylpiperidin-4-ol;trifluoromethylcyclohexane has a molecular weight of 281.36 g/mol, XLogP of 3.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylpiperidin-4-ol;trifluoromethylcyclohexane is sourced from PubChem (CID 155721197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).