About 1-methoxypyrrolidine-2,5-dione;(Z)-N-methyl-4-oxo-N-(6-oxohexyl)but-2-enamide
1-methoxypyrrolidine-2,5-dione;(Z)-N-methyl-4-oxo-N-(6-oxohexyl)but-2-enamide (PubChem CID 155721292) has the molecular formula C16H24N2O6
and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-methoxypyrrolidine-2,5-dione;(Z)-N-methyl-4-oxo-N-(6-oxohexyl)but-2-enamide.
Molecular Properties
| Compound Name | 1-methoxypyrrolidine-2,5-dione;(Z)-N-methyl-4-oxo-N-(6-oxohexyl)but-2-enamide |
| PubChem CID | 155721292 |
| Molecular Formula | C16H24N2O6 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-methoxypyrrolidine-2,5-dione;(Z)-N-methyl-4-oxo-N-(6-oxohexyl)but-2-enamide |
| SMILES | CN(CCCCCC=O)C(=O)/C=C\C=O.CON1C(=O)CCC1=O |
| InChI | InChI=1S/C11H17NO3.C5H7NO3/c1-12(11(15)7-6-10-14)8-4-2-3-5-9-13;1-9-6-4(7)2-3-5(6)8/h6-7,9-10H,2-5,8H2,1H3;2-3H2,1H3/b7-6-; |
| InChIKey | QNFMTWMYUUFVKX-NAFXZHHSSA-N |
| XLogP | 0.66 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxypyrrolidine-2,5-dione;(Z)-N-methyl-4-oxo-N-(6-oxohexyl)but-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypyrrolidine-2,5-dione;(Z)-N-methyl-4-oxo-N-(6-oxohexyl)but-2-enamide?
The IUPAC name of 1-methoxypyrrolidine-2,5-dione;(Z)-N-methyl-4-oxo-N-(6-oxohexyl)but-2-enamide (CID 155721292) is 1-methoxypyrrolidine-2,5-dione;(Z)-N-methyl-4-oxo-N-(6-oxohexyl)but-2-enamide.
What is the SMILES notation for 1-methoxypyrrolidine-2,5-dione;(Z)-N-methyl-4-oxo-N-(6-oxohexyl)but-2-enamide?
The canonical SMILES for 1-methoxypyrrolidine-2,5-dione;(Z)-N-methyl-4-oxo-N-(6-oxohexyl)but-2-enamide is CN(CCCCCC=O)C(=O)/C=C\C=O.CON1C(=O)CCC1=O.
What is the InChIKey of 1-methoxypyrrolidine-2,5-dione;(Z)-N-methyl-4-oxo-N-(6-oxohexyl)but-2-enamide?
The InChIKey is QNFMTWMYUUFVKX-NAFXZHHSSA-N. The full InChI is InChI=1S/C11H17NO3.C5H7NO3/c1-12(11(15)7-6-10-14)8-4-2-3-5-9-13;1-9-6-4(7)2-3-5(6)8/h6-7,9-10H,2-5,8H2,1H3;2-3H2,1H3/b7-6-;.
What are the key properties of 1-methoxypyrrolidine-2,5-dione;(Z)-N-methyl-4-oxo-N-(6-oxohexyl)but-2-enamide?
1-methoxypyrrolidine-2,5-dione;(Z)-N-methyl-4-oxo-N-(6-oxohexyl)but-2-enamide has a molecular weight of 340.38 g/mol, XLogP of 0.66, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypyrrolidine-2,5-dione;(Z)-N-methyl-4-oxo-N-(6-oxohexyl)but-2-enamide is sourced from PubChem (CID 155721292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).