C16H32N2 — CID 155721804
N'-[(3Z)-4,5-dimethylhexa-1,3,5-trien-2-yl]-N,N,N'-trimethylethane-1,2-diamine;propane (PubChem CID 155721804) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is N'-[(3Z)-4,5-dimethylhexa-1,3,5-trien-2-yl]-N,N,N'-trimethylethane-1,2-diamine;propane.
| Compound Name | N'-[(3Z)-4,5-dimethylhexa-1,3,5-trien-2-yl]-N,N,N'-trimethylethane-1,2-diamine;propane |
|---|---|
| PubChem CID | 155721804 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | N'-[(3Z)-4,5-dimethylhexa-1,3,5-trien-2-yl]-N,N,N'-trimethylethane-1,2-diamine;propane |
| SMILES | C=C(C)/C(C)=C\C(=C)N(C)CCN(C)C.CCC |
| InChI | InChI=1S/C13H24N2.C3H8/c1-11(2)12(3)10-13(4)15(7)9-8-14(5)6;1-3-2/h10H,1,4,8-9H2,2-3,5-7H3;3H2,1-2H3/b12-10-; |
| InChIKey | VCWAIWSAMDGIOK-BBJSDXRSSA-N |
| XLogP | 3.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|