C12H12ClN5OS — CID 155721806
13-chloro-2-ethyl-5,9-dimethyl-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one (PubChem CID 155721806) has the molecular formula C12H12ClN5OS and a molecular weight of 309.78 g/mol. Its IUPAC name is 13-chloro-2-ethyl-5,9-dimethyl-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one.
| Compound Name | 13-chloro-2-ethyl-5,9-dimethyl-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
|---|---|
| PubChem CID | 155721806 |
| Molecular Formula | C12H12ClN5OS |
| Molecular Weight | 309.78 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 13-chloro-2-ethyl-5,9-dimethyl-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
| SMILES | CCN1c2nc(Cl)ncc2N(C)C(=O)c2nc(C)sc21 |
| InChI | InChI=1S/C12H12ClN5OS/c1-4-18-9-7(5-14-12(13)16-9)17(3)10(19)8-11(18)20-6(2)15-8/h5H,4H2,1-3H3 |
| InChIKey | PTSHNHVQLDNJLM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.78 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |