About (Z)-N-ethyl-N',2-dimethyl-3-(methylideneamino)prop-2-enimidamide
(Z)-N-ethyl-N',2-dimethyl-3-(methylideneamino)prop-2-enimidamide (PubChem CID 155721817) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is (Z)-N-ethyl-N',2-dimethyl-3-(methylideneamino)prop-2-enimidamide.
Molecular Properties
| Compound Name | (Z)-N-ethyl-N',2-dimethyl-3-(methylideneamino)prop-2-enimidamide |
| PubChem CID | 155721817 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | (Z)-N-ethyl-N',2-dimethyl-3-(methylideneamino)prop-2-enimidamide |
| SMILES | C=N/C=C(C)\C(=N\C)NCC |
| InChI | InChI=1S/C8H15N3/c1-5-11-8(10-4)7(2)6-9-3/h6H,3,5H2,1-2,4H3,(H,10,11)/b7-6- |
| InChIKey | TUBVHDZEWUHNJH-SREVYHEPSA-N |
| XLogP | 1.23 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-ethyl-N',2-dimethyl-3-(methylideneamino)prop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-ethyl-N',2-dimethyl-3-(methylideneamino)prop-2-enimidamide?
The IUPAC name of (Z)-N-ethyl-N',2-dimethyl-3-(methylideneamino)prop-2-enimidamide (CID 155721817) is (Z)-N-ethyl-N',2-dimethyl-3-(methylideneamino)prop-2-enimidamide.
What is the SMILES notation for (Z)-N-ethyl-N',2-dimethyl-3-(methylideneamino)prop-2-enimidamide?
The canonical SMILES for (Z)-N-ethyl-N',2-dimethyl-3-(methylideneamino)prop-2-enimidamide is C=N/C=C(C)\C(=N\C)NCC.
What is the InChIKey of (Z)-N-ethyl-N',2-dimethyl-3-(methylideneamino)prop-2-enimidamide?
The InChIKey is TUBVHDZEWUHNJH-SREVYHEPSA-N. The full InChI is InChI=1S/C8H15N3/c1-5-11-8(10-4)7(2)6-9-3/h6H,3,5H2,1-2,4H3,(H,10,11)/b7-6-.
What are the key properties of (Z)-N-ethyl-N',2-dimethyl-3-(methylideneamino)prop-2-enimidamide?
(Z)-N-ethyl-N',2-dimethyl-3-(methylideneamino)prop-2-enimidamide has a molecular weight of 153.23 g/mol, XLogP of 1.23, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-ethyl-N',2-dimethyl-3-(methylideneamino)prop-2-enimidamide is sourced from PubChem (CID 155721817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).