C12H26N2 — CID 155721820
(2E,4Z)-N,N-dimethylhepta-2,4-dien-2-amine;N,N-dimethylmethanamine (PubChem CID 155721820) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is (2E,4Z)-N,N-dimethylhepta-2,4-dien-2-amine;N,N-dimethylmethanamine.
| Compound Name | (2E,4Z)-N,N-dimethylhepta-2,4-dien-2-amine;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 155721820 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | (2E,4Z)-N,N-dimethylhepta-2,4-dien-2-amine;N,N-dimethylmethanamine |
| SMILES | CC/C=C\C=C(/C)N(C)C.CN(C)C |
| InChI | InChI=1S/C9H17N.C3H9N/c1-5-6-7-8-9(2)10(3)4;1-4(2)3/h6-8H,5H2,1-4H3;1-3H3/b7-6-,9-8+; |
| InChIKey | IUJFOFRQJMXUIN-FTOWGUJXSA-N |
| XLogP | 2.60 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|