C22H26N8O2S — CID 155721845
13-(2-methoxy-4-piperazin-1-ylanilino)-2,5,9-trimethyl-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one (PubChem CID 155721845) has the molecular formula C22H26N8O2S and a molecular weight of 466.57 g/mol. Its IUPAC name is 13-(2-methoxy-4-piperazin-1-ylanilino)-2,5,9-trimethyl-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one.
| Compound Name | 13-(2-methoxy-4-piperazin-1-ylanilino)-2,5,9-trimethyl-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
|---|---|
| PubChem CID | 155721845 |
| Molecular Formula | C22H26N8O2S |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 13-(2-methoxy-4-piperazin-1-ylanilino)-2,5,9-trimethyl-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
| SMILES | COc1cc(N2CCNCC2)ccc1Nc1ncc2c(n1)N(C)c1sc(C)nc1C(=O)N2C |
| InChI | InChI=1S/C22H26N8O2S/c1-13-25-18-20(31)28(2)16-12-24-22(27-19(16)29(3)21(18)33-13)26-15-6-5-14(11-17(15)32-4)30-9-7-23-8-10-30/h5-6,11-12,23H,7-10H2,1-4H3,(H,24,26,27) |
| InChIKey | YQAAYQVBJUQXRF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 98.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |