C15H27N3O3 — CID 155722313
(1E,3E)-N,3-dimethyl-N-(3-morpholin-4-ylpropyl)-2-nitrohexa-1,3-dien-1-amine (PubChem CID 155722313) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is (1E,3E)-N,3-dimethyl-N-(3-morpholin-4-ylpropyl)-2-nitrohexa-1,3-dien-1-amine.
| Compound Name | (1E,3E)-N,3-dimethyl-N-(3-morpholin-4-ylpropyl)-2-nitrohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 155722313 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (1E,3E)-N,3-dimethyl-N-(3-morpholin-4-ylpropyl)-2-nitrohexa-1,3-dien-1-amine |
| SMILES | CC/C=C(C)/C(=C\N(C)CCCN1CCOCC1)[N+](=O)[O-] |
| InChI | InChI=1S/C15H27N3O3/c1-4-6-14(2)15(18(19)20)13-16(3)7-5-8-17-9-11-21-12-10-17/h6,13H,4-5,7-12H2,1-3H3/b14-6+,15-13+ |
| InChIKey | CIZPSXKFUHQYKY-WKRSNNMOSA-N |
| XLogP | 2.11 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|