C13H13Cl2F4NO3 — CID 15572237
2-[4-(1,3-dichloro-1,1,3,3-tetrafluoro-2-hydroxypropan-2-yl)-2,6-dimethylanilino]acetic acid (PubChem CID 15572237) has the molecular formula C13H13Cl2F4NO3 and a molecular weight of 378.15 g/mol. Its IUPAC name is 2-[4-(1,3-dichloro-1,1,3,3-tetrafluoro-2-hydroxypropan-2-yl)-2,6-dimethylanilino]acetic acid.
| Compound Name | 2-[4-(1,3-dichloro-1,1,3,3-tetrafluoro-2-hydroxypropan-2-yl)-2,6-dimethylanilino]acetic acid |
|---|---|
| PubChem CID | 15572237 |
| Molecular Formula | C13H13Cl2F4NO3 |
| Molecular Weight | 378.15 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 2-[4-(1,3-dichloro-1,1,3,3-tetrafluoro-2-hydroxypropan-2-yl)-2,6-dimethylanilino]acetic acid |
| SMILES | Cc1cc(C(O)(C(F)(F)Cl)C(F)(F)Cl)cc(C)c1NCC(=O)O |
| InChI | InChI=1S/C13H13Cl2F4NO3/c1-6-3-8(4-7(2)10(6)20-5-9(21)22)11(23,12(14,16)17)13(15,18)19/h3-4,20,23H,5H2,1-2H3,(H,21,22) |
| InChIKey | RGAOJQVVTGMLSP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.15 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|