C15H19NO2 — CID 155722516
(3Z)-4-[(E)-2,3-dimethylbut-1-enyl]imino-3-ethylidenecyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 155722516) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (3Z)-4-[(E)-2,3-dimethylbut-1-enyl]imino-3-ethylidenecyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | (3Z)-4-[(E)-2,3-dimethylbut-1-enyl]imino-3-ethylidenecyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 155722516 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (3Z)-4-[(E)-2,3-dimethylbut-1-enyl]imino-3-ethylidenecyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | C/C=C1/C=C(C(=O)O)C=C/C1=N\C=C(/C)C(C)C |
| InChI | InChI=1S/C15H19NO2/c1-5-12-8-13(15(17)18)6-7-14(12)16-9-11(4)10(2)3/h5-10H,1-4H3,(H,17,18)/b11-9+,12-5-,16-14+ |
| InChIKey | POLHKGYDIFFHSD-SXEGHUCSSA-N |
| XLogP | 3.51 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|