C25H18FN8O+ — CID 155723222
5-ethynyl-12-fluoro-3,21-dimethyl-10-(4-methylpyrimidin-2-yl)oxy-6,17,19,21-tetraza-8-azoniapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,5,8,10,12,15,17,19-decaen-16-amine (PubChem CID 155723222) has the molecular formula C25H18FN8O+ and a molecular weight of 465.47 g/mol. Its IUPAC name is 5-ethynyl-12-fluoro-3,21-dimethyl-10-(4-methylpyrimidin-2-yl)oxy-6,17,19,21-tetraza-8-azoniapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,5,8,10,12,15,17,19-decaen-16-amine.
| Compound Name | 5-ethynyl-12-fluoro-3,21-dimethyl-10-(4-methylpyrimidin-2-yl)oxy-6,17,19,21-tetraza-8-azoniapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,5,8,10,12,15,17,19-decaen-16-amine |
|---|---|
| PubChem CID | 155723222 |
| Molecular Formula | C25H18FN8O+ |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 5-ethynyl-12-fluoro-3,21-dimethyl-10-(4-methylpyrimidin-2-yl)oxy-6,17,19,21-tetraza-8-azoniapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,5,8,10,12,15,17,19-decaen-16-amine |
| SMILES | C#Cc1cc(C)c2c3c(c4c(N)ncnc4n3C)c3c(F)cc(Oc4nccc(C)n4)c[n+]3c2n1 |
| InChI | InChI=1S/C25H18FN8O/c1-5-14-8-12(2)17-21-18(19-22(27)29-11-30-23(19)33(21)4)20-16(26)9-15(10-34(20)24(17)32-14)35-25-28-7-6-13(3)31-25/h1,6-11H,2-4H3,(H2,27,29,30)/q+1 |
| InChIKey | WMXHHBRZLUSBFT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|