About 5-bromo-2,4-dimethylpyrimidine;ethane
5-bromo-2,4-dimethylpyrimidine;ethane (PubChem CID 155723230) has the molecular formula C8H13BrN2
and a molecular weight of 217.11 g/mol. Its IUPAC name is 5-bromo-2,4-dimethylpyrimidine;ethane.
Molecular Properties
| Compound Name | 5-bromo-2,4-dimethylpyrimidine;ethane |
| PubChem CID | 155723230 |
| Molecular Formula | C8H13BrN2 |
| Molecular Weight | 217.11 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 5-bromo-2,4-dimethylpyrimidine;ethane |
| SMILES | CC.Cc1ncc(Br)c(C)n1 |
| InChI | InChI=1S/C6H7BrN2.C2H6/c1-4-6(7)3-8-5(2)9-4;1-2/h3H,1-2H3;1-2H3 |
| InChIKey | HENIWFCNXYHOGY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.11 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-2,4-dimethylpyrimidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,4-dimethylpyrimidine;ethane?
The IUPAC name of 5-bromo-2,4-dimethylpyrimidine;ethane (CID 155723230) is 5-bromo-2,4-dimethylpyrimidine;ethane.
What is the SMILES notation for 5-bromo-2,4-dimethylpyrimidine;ethane?
The canonical SMILES for 5-bromo-2,4-dimethylpyrimidine;ethane is CC.Cc1ncc(Br)c(C)n1.
What is the InChIKey of 5-bromo-2,4-dimethylpyrimidine;ethane?
The InChIKey is HENIWFCNXYHOGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BrN2.C2H6/c1-4-6(7)3-8-5(2)9-4;1-2/h3H,1-2H3;1-2H3.
What are the key properties of 5-bromo-2,4-dimethylpyrimidine;ethane?
5-bromo-2,4-dimethylpyrimidine;ethane has a molecular weight of 217.11 g/mol, XLogP of 2.88, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,4-dimethylpyrimidine;ethane is sourced from PubChem (CID 155723230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).