C32H51N — CID 155723694
1-[3-[5-[(3E,5E,7E)-3,11-dimethyltrideca-3,5,7,12-tetraenyl]-2-methylcyclohexyl]buta-1,3-dien-2-yl]-2-methylpiperidine (PubChem CID 155723694) has the molecular formula C32H51N and a molecular weight of 449.77 g/mol. Its IUPAC name is 1-[3-[5-[(3E,5E,7E)-3,11-dimethyltrideca-3,5,7,12-tetraenyl]-2-methylcyclohexyl]buta-1,3-dien-2-yl]-2-methylpiperidine.
| Compound Name | 1-[3-[5-[(3E,5E,7E)-3,11-dimethyltrideca-3,5,7,12-tetraenyl]-2-methylcyclohexyl]buta-1,3-dien-2-yl]-2-methylpiperidine |
|---|---|
| PubChem CID | 155723694 |
| Molecular Formula | C32H51N |
| Molecular Weight | 449.77 g/mol |
| Exact Mass | 449.40 |
| IUPAC Name | 1-[3-[5-[(3E,5E,7E)-3,11-dimethyltrideca-3,5,7,12-tetraenyl]-2-methylcyclohexyl]buta-1,3-dien-2-yl]-2-methylpiperidine |
| SMILES | C=CC(C)CC/C=C/C=C/C=C(\C)CCC1CCC(C)C(C(=C)C(=C)N2CCCCC2C)C1 |
| InChI | InChI=1S/C32H51N/c1-8-25(2)16-12-10-9-11-13-17-26(3)19-21-31-22-20-27(4)32(24-31)29(6)30(7)33-23-15-14-18-28(33)5/h8-11,13,17,25,27-28,31-32H,1,6-7,12,14-16,18-24H2,2-5H3/b10-9+,13-11+,26-17+ |
| InChIKey | SOEMAFZIRKOKQO-OBVAIOMHSA-N |
| XLogP | 9.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.77 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|