About ethane;3-ethyl-4-methylpenta-1,3-diene;N-prop-1-en-2-ylcyclohexanamine
ethane;3-ethyl-4-methylpenta-1,3-diene;N-prop-1-en-2-ylcyclohexanamine (PubChem CID 155724054) has the molecular formula C19H37N
and a molecular weight of 279.51 g/mol. Its IUPAC name is ethane;3-ethyl-4-methylpenta-1,3-diene;N-prop-1-en-2-ylcyclohexanamine.
Molecular Properties
| Compound Name | ethane;3-ethyl-4-methylpenta-1,3-diene;N-prop-1-en-2-ylcyclohexanamine |
| PubChem CID | 155724054 |
| Molecular Formula | C19H37N |
| Molecular Weight | 279.51 g/mol |
| Exact Mass | 279.29 |
| IUPAC Name | ethane;3-ethyl-4-methylpenta-1,3-diene;N-prop-1-en-2-ylcyclohexanamine |
| SMILES | C=C(C)NC1CCCCC1.C=CC(CC)=C(C)C.CC |
| InChI | InChI=1S/C9H17N.C8H14.C2H6/c1-8(2)10-9-6-4-3-5-7-9;1-5-8(6-2)7(3)4;1-2/h9-10H,1,3-7H2,2H3;5H,1,6H2,2-4H3;1-2H3 |
| InChIKey | SXKMHWQXUWDHJO-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 279.51 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-ethyl-4-methylpenta-1,3-diene;N-prop-1-en-2-ylcyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-ethyl-4-methylpenta-1,3-diene;N-prop-1-en-2-ylcyclohexanamine?
The IUPAC name of ethane;3-ethyl-4-methylpenta-1,3-diene;N-prop-1-en-2-ylcyclohexanamine (CID 155724054) is ethane;3-ethyl-4-methylpenta-1,3-diene;N-prop-1-en-2-ylcyclohexanamine.
What is the SMILES notation for ethane;3-ethyl-4-methylpenta-1,3-diene;N-prop-1-en-2-ylcyclohexanamine?
The canonical SMILES for ethane;3-ethyl-4-methylpenta-1,3-diene;N-prop-1-en-2-ylcyclohexanamine is C=C(C)NC1CCCCC1.C=CC(CC)=C(C)C.CC.
What is the InChIKey of ethane;3-ethyl-4-methylpenta-1,3-diene;N-prop-1-en-2-ylcyclohexanamine?
The InChIKey is SXKMHWQXUWDHJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N.C8H14.C2H6/c1-8(2)10-9-6-4-3-5-7-9;1-5-8(6-2)7(3)4;1-2/h9-10H,1,3-7H2,2H3;5H,1,6H2,2-4H3;1-2H3.
What are the key properties of ethane;3-ethyl-4-methylpenta-1,3-diene;N-prop-1-en-2-ylcyclohexanamine?
ethane;3-ethyl-4-methylpenta-1,3-diene;N-prop-1-en-2-ylcyclohexanamine has a molecular weight of 279.51 g/mol, XLogP of 6.39, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethyl-4-methylpenta-1,3-diene;N-prop-1-en-2-ylcyclohexanamine is sourced from PubChem (CID 155724054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).