About [3,5-dihydroxy-4-(3-methylcyclohex-2-en-1-yl)phenyl] trifluoromethanesulfinate;prop-1-ene
[3,5-dihydroxy-4-(3-methylcyclohex-2-en-1-yl)phenyl] trifluoromethanesulfinate;prop-1-ene (PubChem CID 155724385) has the molecular formula C17H21F3O4S
and a molecular weight of 378.41 g/mol. Its IUPAC name is [3,5-dihydroxy-4-(3-methylcyclohex-2-en-1-yl)phenyl] trifluoromethanesulfinate;prop-1-ene.
Molecular Properties
| Compound Name | [3,5-dihydroxy-4-(3-methylcyclohex-2-en-1-yl)phenyl] trifluoromethanesulfinate;prop-1-ene |
| PubChem CID | 155724385 |
| Molecular Formula | C17H21F3O4S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | [3,5-dihydroxy-4-(3-methylcyclohex-2-en-1-yl)phenyl] trifluoromethanesulfinate;prop-1-ene |
| SMILES | C=CC.CC1=CC(c2c(O)cc(OS(=O)C(F)(F)F)cc2O)CCC1 |
| InChI | InChI=1S/C14H15F3O4S.C3H6/c1-8-3-2-4-9(5-8)13-11(18)6-10(7-12(13)19)21-22(20)14(15,16)17;1-3-2/h5-7,9,18-19H,2-4H2,1H3;3H,1H2,2H3 |
| InChIKey | QDEOWSXIIGWAFW-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [3,5-dihydroxy-4-(3-methylcyclohex-2-en-1-yl)phenyl] trifluoromethanesulfinate;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-dihydroxy-4-(3-methylcyclohex-2-en-1-yl)phenyl] trifluoromethanesulfinate;prop-1-ene?
The IUPAC name of [3,5-dihydroxy-4-(3-methylcyclohex-2-en-1-yl)phenyl] trifluoromethanesulfinate;prop-1-ene (CID 155724385) is [3,5-dihydroxy-4-(3-methylcyclohex-2-en-1-yl)phenyl] trifluoromethanesulfinate;prop-1-ene.
What is the SMILES notation for [3,5-dihydroxy-4-(3-methylcyclohex-2-en-1-yl)phenyl] trifluoromethanesulfinate;prop-1-ene?
The canonical SMILES for [3,5-dihydroxy-4-(3-methylcyclohex-2-en-1-yl)phenyl] trifluoromethanesulfinate;prop-1-ene is C=CC.CC1=CC(c2c(O)cc(OS(=O)C(F)(F)F)cc2O)CCC1.
What is the InChIKey of [3,5-dihydroxy-4-(3-methylcyclohex-2-en-1-yl)phenyl] trifluoromethanesulfinate;prop-1-ene?
The InChIKey is QDEOWSXIIGWAFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F3O4S.C3H6/c1-8-3-2-4-9(5-8)13-11(18)6-10(7-12(13)19)21-22(20)14(15,16)17;1-3-2/h5-7,9,18-19H,2-4H2,1H3;3H,1H2,2H3.
What are the key properties of [3,5-dihydroxy-4-(3-methylcyclohex-2-en-1-yl)phenyl] trifluoromethanesulfinate;prop-1-ene?
[3,5-dihydroxy-4-(3-methylcyclohex-2-en-1-yl)phenyl] trifluoromethanesulfinate;prop-1-ene has a molecular weight of 378.41 g/mol, XLogP of 5.07, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-dihydroxy-4-(3-methylcyclohex-2-en-1-yl)phenyl] trifluoromethanesulfinate;prop-1-ene is sourced from PubChem (CID 155724385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).