C25H30O3 — CID 155724425
5-(1-benzofuran-2-yl)-2-[(E)-2,5,7-trimethyloct-4-en-2-yl]benzene-1,3-diol (PubChem CID 155724425) has the molecular formula C25H30O3 and a molecular weight of 378.51 g/mol. Its IUPAC name is 5-(1-benzofuran-2-yl)-2-[(E)-2,5,7-trimethyloct-4-en-2-yl]benzene-1,3-diol.
| Compound Name | 5-(1-benzofuran-2-yl)-2-[(E)-2,5,7-trimethyloct-4-en-2-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 155724425 |
| Molecular Formula | C25H30O3 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 5-(1-benzofuran-2-yl)-2-[(E)-2,5,7-trimethyloct-4-en-2-yl]benzene-1,3-diol |
| SMILES | C/C(=C\CC(C)(C)c1c(O)cc(-c2cc3ccccc3o2)cc1O)CC(C)C |
| InChI | InChI=1S/C25H30O3/c1-16(2)12-17(3)10-11-25(4,5)24-20(26)13-19(14-21(24)27)23-15-18-8-6-7-9-22(18)28-23/h6-10,13-16,26-27H,11-12H2,1-5H3/b17-10+ |
| InChIKey | UYTICTRLOOQGHL-LICLKQGHSA-N |
| XLogP | 7.17 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|