C12Cl2F20Si — CID 155724433
dichloro-[2,3,4,5,6,6-hexafluoro-1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexa-2,4-dien-1-yl]-(1,1,2,2,2-pentafluoroethyl)silane (PubChem CID 155724433) has the molecular formula C12Cl2F20Si and a molecular weight of 623.08 g/mol. Its IUPAC name is dichloro-[2,3,4,5,6,6-hexafluoro-1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexa-2,4-dien-1-yl]-(1,1,2,2,2-pentafluoroethyl)silane.
| Compound Name | dichloro-[2,3,4,5,6,6-hexafluoro-1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexa-2,4-dien-1-yl]-(1,1,2,2,2-pentafluoroethyl)silane |
|---|---|
| PubChem CID | 155724433 |
| Molecular Formula | C12Cl2F20Si |
| Molecular Weight | 623.08 g/mol |
| Exact Mass | 621.88 |
| IUPAC Name | dichloro-[2,3,4,5,6,6-hexafluoro-1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexa-2,4-dien-1-yl]-(1,1,2,2,2-pentafluoroethyl)silane |
| SMILES | FC1=C(F)C(F)(F)C(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)([Si](Cl)(Cl)C(F)(F)C(F)(F)F)C(F)=C1F |
| InChI | InChI=1S/C12Cl2F20Si/c13-35(14,12(33,34)11(30,31)32)5(3(17)1(15)2(16)4(18)6(5,19)20)7(21,22)8(23,24)9(25,26)10(27,28)29 |
| InChIKey | VPOCQTUFVUYWKS-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.08 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|