About ethane;5,7,7-trimethyl-3-azabicyclo[3.2.1]octan-2-one
ethane;5,7,7-trimethyl-3-azabicyclo[3.2.1]octan-2-one (PubChem CID 155724694) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is ethane;5,7,7-trimethyl-3-azabicyclo[3.2.1]octan-2-one.
Molecular Properties
| Compound Name | ethane;5,7,7-trimethyl-3-azabicyclo[3.2.1]octan-2-one |
| PubChem CID | 155724694 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | ethane;5,7,7-trimethyl-3-azabicyclo[3.2.1]octan-2-one |
| SMILES | CC.CC12CNC(=O)C(C1)C(C)(C)C2 |
| InChI | InChI=1S/C10H17NO.C2H6/c1-9(2)5-10(3)4-7(9)8(12)11-6-10;1-2/h7H,4-6H2,1-3H3,(H,11,12);1-2H3 |
| InChIKey | XDGZCKNYFPYAER-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;5,7,7-trimethyl-3-azabicyclo[3.2.1]octan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5,7,7-trimethyl-3-azabicyclo[3.2.1]octan-2-one?
The IUPAC name of ethane;5,7,7-trimethyl-3-azabicyclo[3.2.1]octan-2-one (CID 155724694) is ethane;5,7,7-trimethyl-3-azabicyclo[3.2.1]octan-2-one.
What is the SMILES notation for ethane;5,7,7-trimethyl-3-azabicyclo[3.2.1]octan-2-one?
The canonical SMILES for ethane;5,7,7-trimethyl-3-azabicyclo[3.2.1]octan-2-one is CC.CC12CNC(=O)C(C1)C(C)(C)C2.
What is the InChIKey of ethane;5,7,7-trimethyl-3-azabicyclo[3.2.1]octan-2-one?
The InChIKey is XDGZCKNYFPYAER-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO.C2H6/c1-9(2)5-10(3)4-7(9)8(12)11-6-10;1-2/h7H,4-6H2,1-3H3,(H,11,12);1-2H3.
What are the key properties of ethane;5,7,7-trimethyl-3-azabicyclo[3.2.1]octan-2-one?
ethane;5,7,7-trimethyl-3-azabicyclo[3.2.1]octan-2-one has a molecular weight of 197.32 g/mol, XLogP of 2.58, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5,7,7-trimethyl-3-azabicyclo[3.2.1]octan-2-one is sourced from PubChem (CID 155724694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).