C18H31N3O4 — CID 155724821
N-[3-(dimethoxymethyl)phenyl]-2-[[2-(methylamino)acetyl]amino]propanamide;propane (PubChem CID 155724821) has the molecular formula C18H31N3O4 and a molecular weight of 353.46 g/mol. Its IUPAC name is N-[3-(dimethoxymethyl)phenyl]-2-[[2-(methylamino)acetyl]amino]propanamide;propane.
| Compound Name | N-[3-(dimethoxymethyl)phenyl]-2-[[2-(methylamino)acetyl]amino]propanamide;propane |
|---|---|
| PubChem CID | 155724821 |
| Molecular Formula | C18H31N3O4 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | N-[3-(dimethoxymethyl)phenyl]-2-[[2-(methylamino)acetyl]amino]propanamide;propane |
| SMILES | CCC.CNCC(=O)NC(C)C(=O)Nc1cccc(C(OC)OC)c1 |
| InChI | InChI=1S/C15H23N3O4.C3H8/c1-10(17-13(19)9-16-2)14(20)18-12-7-5-6-11(8-12)15(21-3)22-4;1-3-2/h5-8,10,15-16H,9H2,1-4H3,(H,17,19)(H,18,20);3H2,1-2H3 |
| InChIKey | DNUFAUUDCRNCDT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|