C23H19ClF2N4O2 — CID 155725344
3-(4-chloro-3-cyclohexylanilino)-4-[(5,6-difluoro-1H-pyrrolo[3,2-b]pyridin-3-yl)amino]cyclobut-3-ene-1,2-dione (PubChem CID 155725344) has the molecular formula C23H19ClF2N4O2 and a molecular weight of 456.88 g/mol. Its IUPAC name is 3-(4-chloro-3-cyclohexylanilino)-4-[(5,6-difluoro-1H-pyrrolo[3,2-b]pyridin-3-yl)amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(4-chloro-3-cyclohexylanilino)-4-[(5,6-difluoro-1H-pyrrolo[3,2-b]pyridin-3-yl)amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 155725344 |
| Molecular Formula | C23H19ClF2N4O2 |
| Molecular Weight | 456.88 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 3-(4-chloro-3-cyclohexylanilino)-4-[(5,6-difluoro-1H-pyrrolo[3,2-b]pyridin-3-yl)amino]cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(Nc2ccc(Cl)c(C3CCCCC3)c2)c(Nc2c[nH]c3cc(F)c(F)nc23)c1=O |
| InChI | InChI=1S/C23H19ClF2N4O2/c24-14-7-6-12(8-13(14)11-4-2-1-3-5-11)28-19-20(22(32)21(19)31)29-17-10-27-16-9-15(25)23(26)30-18(16)17/h6-11,27-29H,1-5H2 |
| InChIKey | PRJAYTHGZAMMCD-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.88 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|