C32H62O6Si2 — CID 155725383
cyclohexylmethyl (E,6R)-6-[(2R,3R,5R,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]oxyhept-2-enoate (PubChem CID 155725383) has the molecular formula C32H62O6Si2 and a molecular weight of 599.01 g/mol. Its IUPAC name is cyclohexylmethyl (E,6R)-6-[(2R,3R,5R,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]oxyhept-2-enoate.
| Compound Name | cyclohexylmethyl (E,6R)-6-[(2R,3R,5R,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]oxyhept-2-enoate |
|---|---|
| PubChem CID | 155725383 |
| Molecular Formula | C32H62O6Si2 |
| Molecular Weight | 599.01 g/mol |
| Exact Mass | 598.41 |
| IUPAC Name | cyclohexylmethyl (E,6R)-6-[(2R,3R,5R,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]oxyhept-2-enoate |
| SMILES | C[C@H](CC/C=C/C(=O)OCC1CCCCC1)O[C@@H]1O[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H62O6Si2/c1-24(18-16-17-21-29(33)34-23-26-19-14-13-15-20-26)35-30-28(38-40(11,12)32(6,7)8)22-27(25(2)36-30)37-39(9,10)31(3,4)5/h17,21,24-28,30H,13-16,18-20,22-23H2,1-12H3/b21-17+/t24-,25+,27-,28-,30-/m1/s1 |
| InChIKey | WAKKWTFHAFVDQP-BZUVFLLSSA-N |
| XLogP | 8.77 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.01 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|