C30H60O6Si2 — CID 155725412
tert-butyl (E)-6-[(2S,3R,5R,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]oxy-6-methylhept-2-enoate (PubChem CID 155725412) has the molecular formula C30H60O6Si2 and a molecular weight of 572.98 g/mol. Its IUPAC name is tert-butyl (E)-6-[(2S,3R,5R,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]oxy-6-methylhept-2-enoate.
| Compound Name | tert-butyl (E)-6-[(2S,3R,5R,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]oxy-6-methylhept-2-enoate |
|---|---|
| PubChem CID | 155725412 |
| Molecular Formula | C30H60O6Si2 |
| Molecular Weight | 572.98 g/mol |
| Exact Mass | 572.39 |
| IUPAC Name | tert-butyl (E)-6-[(2S,3R,5R,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]oxy-6-methylhept-2-enoate |
| SMILES | C[C@@H]1O[C@@H](OC(C)(C)CC/C=C/C(=O)OC(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H60O6Si2/c1-22-23(35-37(13,14)28(5,6)7)21-24(36-38(15,16)29(8,9)10)26(32-22)34-30(11,12)20-18-17-19-25(31)33-27(2,3)4/h17,19,22-24,26H,18,20-21H2,1-16H3/b19-17+/t22-,23+,24+,26-/m0/s1 |
| InChIKey | LWXZZBVMLCVSBV-KBEMVRJPSA-N |
| XLogP | 8.38 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.98 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|